C7H13NO2 — CID 45083500
(2R,6S)-2,6-dimethylmorpholine-4-carbaldehyde (PubChem CID 45083500) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethylmorpholine-4-carbaldehyde.
| Compound Name | (2R,6S)-2,6-dimethylmorpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 45083500 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2R,6S)-2,6-dimethylmorpholine-4-carbaldehyde |
| SMILES | C[C@@H]1CN(C=O)C[C@H](C)O1 |
| InChI | InChI=1S/C7H13NO2/c1-6-3-8(5-9)4-7(2)10-6/h5-7H,3-4H2,1-2H3/t6-,7+ |
| InChIKey | FTMXVDOMPAZWLQ-KNVOCYPGSA-N |
| XLogP | 0.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|