C13H25NO — CID 143325399
2,6-dimethyl-4-[(2E)-penta-2,4-dien-2-yl]morpholine;ethane (PubChem CID 143325399) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(2E)-penta-2,4-dien-2-yl]morpholine;ethane.
| Compound Name | 2,6-dimethyl-4-[(2E)-penta-2,4-dien-2-yl]morpholine;ethane |
|---|---|
| PubChem CID | 143325399 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2,6-dimethyl-4-[(2E)-penta-2,4-dien-2-yl]morpholine;ethane |
| SMILES | C=C/C=C(\C)N1CC(C)OC(C)C1.CC |
| InChI | InChI=1S/C11H19NO.C2H6/c1-5-6-9(2)12-7-10(3)13-11(4)8-12;1-2/h5-6,10-11H,1,7-8H2,2-4H3;1-2H3/b9-6+; |
| InChIKey | QVXHLYOWDKMYQO-MLBSPLJJSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|