C9H16N2O2 — CID 23039338
N-(2,6-dimethylmorpholin-4-yl)prop-2-enamide (PubChem CID 23039338) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-(2,6-dimethylmorpholin-4-yl)prop-2-enamide.
| Compound Name | N-(2,6-dimethylmorpholin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23039338 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-(2,6-dimethylmorpholin-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)NN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C9H16N2O2/c1-4-9(12)10-11-5-7(2)13-8(3)6-11/h4,7-8H,1,5-6H2,2-3H3,(H,10,12) |
| InChIKey | PJSGJSAQVXMNLG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|