C10H17Cl3N2O2 — CID 3103514
N-[2,2,2-trichloro-1-(2,6-dimethylmorpholin-4-yl)ethyl]acetamide (PubChem CID 3103514) has the molecular formula C10H17Cl3N2O2 and a molecular weight of 303.62 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(2,6-dimethylmorpholin-4-yl)ethyl]acetamide.
| Compound Name | N-[2,2,2-trichloro-1-(2,6-dimethylmorpholin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 3103514 |
| Molecular Formula | C10H17Cl3N2O2 |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | N-[2,2,2-trichloro-1-(2,6-dimethylmorpholin-4-yl)ethyl]acetamide |
| SMILES | CC(=O)NC(N1CC(C)OC(C)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H17Cl3N2O2/c1-6-4-15(5-7(2)17-6)9(10(11,12)13)14-8(3)16/h6-7,9H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | INQURHWBKQKKHZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|