C11H21NO3 — CID 104959290
3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoic acid (PubChem CID 104959290) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoic acid.
| Compound Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 104959290 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylbutanoic acid |
| SMILES | CC(C(=O)O)C(C)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C11H21NO3/c1-7-5-12(6-8(2)15-7)10(4)9(3)11(13)14/h7-10H,5-6H2,1-4H3,(H,13,14)/t7-,8+,9?,10? |
| InChIKey | LKMHLZZRVKZDJL-BQKDNTBBSA-N |
| XLogP | 1.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |