C10H19NO3 — CID 103936716
methyl 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoate (PubChem CID 103936716) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoate.
| Compound Name | methyl 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 103936716 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoate |
| SMILES | COC(=O)C(C)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C10H19NO3/c1-7-5-11(6-8(2)14-7)9(3)10(12)13-4/h7-9H,5-6H2,1-4H3/t7-,8+,9? |
| InChIKey | ZKCRIKYQFUMXLX-JVHMLUBASA-N |
| XLogP | 0.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |