C15H22N2O2 — CID 82256494
1-(4-aminophenyl)-2-(2,6-dimethylmorpholin-4-yl)propan-1-one (PubChem CID 82256494) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(2,6-dimethylmorpholin-4-yl)propan-1-one.
| Compound Name | 1-(4-aminophenyl)-2-(2,6-dimethylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 82256494 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(4-aminophenyl)-2-(2,6-dimethylmorpholin-4-yl)propan-1-one |
| SMILES | CC1CN(C(C)C(=O)c2ccc(N)cc2)CC(C)O1 |
| InChI | InChI=1S/C15H22N2O2/c1-10-8-17(9-11(2)19-10)12(3)15(18)13-4-6-14(16)7-5-13/h4-7,10-12H,8-9,16H2,1-3H3 |
| InChIKey | VMSWUBCHGRRGBU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|