C10H19NO3 — CID 62972695
methyl 2-(2-methyl-1,4-oxazepan-4-yl)propanoate (PubChem CID 62972695) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 2-(2-methyl-1,4-oxazepan-4-yl)propanoate.
| Compound Name | methyl 2-(2-methyl-1,4-oxazepan-4-yl)propanoate |
|---|---|
| PubChem CID | 62972695 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl 2-(2-methyl-1,4-oxazepan-4-yl)propanoate |
| SMILES | COC(=O)C(C)N1CCCOC(C)C1 |
| InChI | InChI=1S/C10H19NO3/c1-8-7-11(5-4-6-14-8)9(2)10(12)13-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | CXYMXAJHBDTNLJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |