C11H23N3O2 — CID 63583173
3-methyl-2-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide (PubChem CID 63583173) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-methyl-2-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide.
| Compound Name | 3-methyl-2-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide |
|---|---|
| PubChem CID | 63583173 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-methyl-2-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide |
| SMILES | CC1CN(C(C(=O)NN)C(C)C)CCCO1 |
| InChI | InChI=1S/C11H23N3O2/c1-8(2)10(11(15)13-12)14-5-4-6-16-9(3)7-14/h8-10H,4-7,12H2,1-3H3,(H,13,15) |
| InChIKey | PPGQZHDSWREGGE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|