2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid

C10H19NO4 — CID 103224901

IUPAC2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid
SMILESCOCC(C(=O)O)N1C[C@@H](C)O[C@@H](C)C1
InChIInChI=1S/C10H19NO4/c1-7-4-11(5-8(2)15-7)9(6-14-3)10(12)13/h7-9H,4-6H2,1-3H3,(H,12,13)/t7-,8+,9?
InChIKeyVBBVLRBVMWIQLI-JVHMLUBASA-N
MW217.26 g/mol
LogP0.20
Rot. Bonds4

About 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid

2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid (PubChem CID 103224901) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid.

Molecular Properties

Compound Name2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid
PubChem CID103224901
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid
SMILESCOCC(C(=O)O)N1C[C@@H](C)O[C@@H](C)C1
InChIInChI=1S/C10H19NO4/c1-7-4-11(5-8(2)15-7)9(6-14-3)10(12)13/h7-9H,4-6H2,1-3H3,(H,12,13)/t7-,8+,9?
InChIKeyVBBVLRBVMWIQLI-JVHMLUBASA-N
XLogP0.20
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid?
The IUPAC name of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid (CID 103224901) is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid.
What is the SMILES notation for 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid?
The canonical SMILES for 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid is COCC(C(=O)O)N1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid?
The InChIKey is VBBVLRBVMWIQLI-JVHMLUBASA-N. The full InChI is InChI=1S/C10H19NO4/c1-7-4-11(5-8(2)15-7)9(6-14-3)10(12)13/h7-9H,4-6H2,1-3H3,(H,12,13)/t7-,8+,9?.
What are the key properties of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid?
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid has a molecular weight of 217.26 g/mol, XLogP of 0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-methoxypropanoic acid is sourced from PubChem (CID 103224901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).