C10H18NO3+ — CID 158879294
(2R)-3-methoxy-2-(4-methyl-3,4,5,6-tetrahydro-2H-pyridin-5-ylium-1-yl)propanoic acid (PubChem CID 158879294) has the molecular formula C10H18NO3+ and a molecular weight of 200.26 g/mol. Its IUPAC name is (2R)-3-methoxy-2-(4-methyl-3,4,5,6-tetrahydro-2H-pyridin-5-ylium-1-yl)propanoic acid.
| Compound Name | (2R)-3-methoxy-2-(4-methyl-3,4,5,6-tetrahydro-2H-pyridin-5-ylium-1-yl)propanoic acid |
|---|---|
| PubChem CID | 158879294 |
| Molecular Formula | C10H18NO3+ |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (2R)-3-methoxy-2-(4-methyl-3,4,5,6-tetrahydro-2H-pyridin-5-ylium-1-yl)propanoic acid |
| SMILES | COC[C@H](C(=O)O)N1C[CH+]C(C)CC1 |
| InChI | InChI=1S/C10H17NO3/c1-8-3-5-11(6-4-8)9(7-14-2)10(12)13/h3,8-9H,4-7H2,1-2H3/p+1/t8?,9-/m1/s1 |
| InChIKey | NWRGMPBUUDXAGQ-YGPZHTELSA-O |
| XLogP | 0.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|