C15H18Cl3N3O4 — CID 27340054
4-nitro-N-[(1R)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]benzamide (PubChem CID 27340054) has the molecular formula C15H18Cl3N3O4 and a molecular weight of 410.69 g/mol. Its IUPAC name is 4-nitro-N-[(1R)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]benzamide.
| Compound Name | 4-nitro-N-[(1R)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 27340054 |
| Molecular Formula | C15H18Cl3N3O4 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-nitro-N-[(1R)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]benzamide |
| SMILES | C[C@@H]1CN([C@@H](NC(=O)c2ccc([N+](=O)[O-])cc2)C(Cl)(Cl)Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18Cl3N3O4/c1-9-7-20(8-10(2)25-9)14(15(16,17)18)19-13(22)11-3-5-12(6-4-11)21(23)24/h3-6,9-10,14H,7-8H2,1-2H3,(H,19,22)/t9-,10+,14-/m1/s1 |
| InChIKey | NYFHBIAJUKMRKB-ISTVAULSSA-N |
| XLogP | 3.13 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|