C7H13NOS — CID 154158068
(2S,6R)-2,6-dimethylthiomorpholine-4-carbaldehyde (PubChem CID 154158068) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylthiomorpholine-4-carbaldehyde.
| Compound Name | (2S,6R)-2,6-dimethylthiomorpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 154158068 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (2S,6R)-2,6-dimethylthiomorpholine-4-carbaldehyde |
| SMILES | C[C@@H]1CN(C=O)C[C@H](C)S1 |
| InChI | InChI=1S/C7H13NOS/c1-6-3-8(5-9)4-7(2)10-6/h5-7H,3-4H2,1-2H3/t6-,7+ |
| InChIKey | SYXPLTLMILVKGA-KNVOCYPGSA-N |
| XLogP | 0.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|