C7H14N2O — CID 171516539
3,5-dimethyl-1,3-diazinane-1-carbaldehyde (PubChem CID 171516539) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-diazinane-1-carbaldehyde.
| Compound Name | 3,5-dimethyl-1,3-diazinane-1-carbaldehyde |
|---|---|
| PubChem CID | 171516539 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3,5-dimethyl-1,3-diazinane-1-carbaldehyde |
| SMILES | CC1CN(C)CN(C=O)C1 |
| InChI | InChI=1S/C7H14N2O/c1-7-3-8(2)5-9(4-7)6-10/h6-7H,3-5H2,1-2H3 |
| InChIKey | FAJAGIRZYVOTHG-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|