C14H30N2O — CID 158498308
bis(1,3-dimethylazetidine);3-methyloxetane (PubChem CID 158498308) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is bis(1,3-dimethylazetidine);3-methyloxetane.
| Compound Name | bis(1,3-dimethylazetidine);3-methyloxetane |
|---|---|
| PubChem CID | 158498308 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | bis(1,3-dimethylazetidine);3-methyloxetane |
| SMILES | CC1CN(C)C1.CC1CN(C)C1.CC1COC1 |
| InChI | InChI=1S/2C5H11N.C4H8O/c2*1-5-3-6(2)4-5;1-4-2-5-3-4/h2*5H,3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | HJOJELWCIJNDCQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |