C7H14FN — CID 177326802
(3S)-3-fluoro-1,5-dimethylpiperidine (PubChem CID 177326802) has the molecular formula C7H14FN and a molecular weight of 131.19 g/mol. Its IUPAC name is (3S)-3-fluoro-1,5-dimethylpiperidine.
| Compound Name | (3S)-3-fluoro-1,5-dimethylpiperidine |
|---|---|
| PubChem CID | 177326802 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | (3S)-3-fluoro-1,5-dimethylpiperidine |
| SMILES | CC1C[C@H](F)CN(C)C1 |
| InChI | InChI=1S/C7H14FN/c1-6-3-7(8)5-9(2)4-6/h6-7H,3-5H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | FXGBBCLOXJMUNH-MLWJPKLSSA-N |
| XLogP | 1.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |