C8H15FN2 — CID 174083626
(5R)-7-fluoro-3-methyl-3,9-diazabicyclo[3.3.1]nonane (PubChem CID 174083626) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is (5R)-7-fluoro-3-methyl-3,9-diazabicyclo[3.3.1]nonane.
| Compound Name | (5R)-7-fluoro-3-methyl-3,9-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 174083626 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (5R)-7-fluoro-3-methyl-3,9-diazabicyclo[3.3.1]nonane |
| SMILES | CN1CC2CC(F)C[C@H](C1)N2 |
| InChI | InChI=1S/C8H15FN2/c1-11-4-7-2-6(9)3-8(5-11)10-7/h6-8,10H,2-5H2,1H3/t6?,7-,8?/m1/s1 |
| InChIKey | PVBLKCDHPYVTOS-ZUEIMRROSA-N |
| XLogP | 0.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |