C5H10FN — CID 175740234
(2S,4R)-2-deuterio-4-fluoro-1-methylpyrrolidine (PubChem CID 175740234) has the molecular formula C5H10FN and a molecular weight of 104.15 g/mol. Its IUPAC name is (2S,4R)-2-deuterio-4-fluoro-1-methylpyrrolidine.
| Compound Name | (2S,4R)-2-deuterio-4-fluoro-1-methylpyrrolidine |
|---|---|
| PubChem CID | 175740234 |
| Molecular Formula | C5H10FN |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.09 |
| IUPAC Name | (2S,4R)-2-deuterio-4-fluoro-1-methylpyrrolidine |
| SMILES | [2H][C@H]1C[C@@H](F)CN1C |
| InChI | InChI=1S/C5H10FN/c1-7-3-2-5(6)4-7/h5H,2-4H2,1H3/t5-/m1/s1/i3D/t3-,5+/m0 |
| InChIKey | ZAMXVCJJAQXCBT-UCSLHKBSSA-N |
| XLogP | 0.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |