C8H16N4O — CID 139631126
4-formyl-2,6-dimethylpiperazine-1-carboximidamide (PubChem CID 139631126) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-formyl-2,6-dimethylpiperazine-1-carboximidamide.
| Compound Name | 4-formyl-2,6-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 139631126 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 4-formyl-2,6-dimethylpiperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1C(C)CN(C=O)CC1C |
| InChI | InChI=1S/C8H16N4O/c1-6-3-11(5-13)4-7(2)12(6)8(9)10/h5-7H,3-4H2,1-2H3,(H3,9,10) |
| InChIKey | XSZUFENPCUEIHR-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|