C9H19NO2 — CID 89016342
(2S,6R)-4-(2-methoxyethyl)-2,6-dimethylmorpholine (PubChem CID 89016342) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S,6R)-4-(2-methoxyethyl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(2-methoxyethyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 89016342 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2S,6R)-4-(2-methoxyethyl)-2,6-dimethylmorpholine |
| SMILES | COCCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C9H19NO2/c1-8-6-10(4-5-11-3)7-9(2)12-8/h8-9H,4-7H2,1-3H3/t8-,9+ |
| InChIKey | XPJXZAXERKSTQC-DTORHVGOSA-N |
| XLogP | 0.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |