About (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine
(2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine (PubChem CID 97102416) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine.
Molecular Properties
| Compound Name | (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine |
| PubChem CID | 97102416 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine |
| SMILES | C[C@@H]1CN(CCOC2CCNCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H26N2O2/c1-11-9-15(10-12(2)17-11)7-8-16-13-3-5-14-6-4-13/h11-14H,3-10H2,1-2H3/t11-,12+ |
| InChIKey | OEJUTPHECMERII-TXEJJXNPSA-N |
| XLogP | 0.86 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine?
The IUPAC name of (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine (CID 97102416) is (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine.
What is the SMILES notation for (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine?
The canonical SMILES for (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine is C[C@@H]1CN(CCOC2CCNCC2)C[C@H](C)O1.
What is the InChIKey of (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine?
The InChIKey is OEJUTPHECMERII-TXEJJXNPSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-11-9-15(10-12(2)17-11)7-8-16-13-3-5-14-6-4-13/h11-14H,3-10H2,1-2H3/t11-,12+.
What are the key properties of (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine?
(2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine has a molecular weight of 242.36 g/mol, XLogP of 0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-dimethyl-4-(2-piperidin-4-yloxyethyl)morpholine is sourced from PubChem (CID 97102416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).