C10H21NO2S — CID 163495367
(2R,6S)-2,6-dimethyl-4-(3-methylsulfanyloxypropyl)morpholine (PubChem CID 163495367) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-(3-methylsulfanyloxypropyl)morpholine.
| Compound Name | (2R,6S)-2,6-dimethyl-4-(3-methylsulfanyloxypropyl)morpholine |
|---|---|
| PubChem CID | 163495367 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-(3-methylsulfanyloxypropyl)morpholine |
| SMILES | CSOCCCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C10H21NO2S/c1-9-7-11(8-10(2)13-9)5-4-6-12-14-3/h9-10H,4-8H2,1-3H3/t9-,10+ |
| InChIKey | CQFYNIZMDHCUJA-AOOOYVTPSA-N |
| XLogP | 1.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|