C5H11NO — CID 118932917
(5S)-3,5-dimethyl-1,3-oxazolidine (PubChem CID 118932917) has the molecular formula C5H11NO and a molecular weight of 101.15 g/mol. Its IUPAC name is (5S)-3,5-dimethyl-1,3-oxazolidine.
| Compound Name | (5S)-3,5-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 118932917 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | (5S)-3,5-dimethyl-1,3-oxazolidine |
| SMILES | C[C@H]1CN(C)CO1 |
| InChI | InChI=1S/C5H11NO/c1-5-3-6(2)4-7-5/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | HMZVWIBGZOAGIO-YFKPBYRVSA-N |
| XLogP | 0.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |