C15H32N2O4 — CID 153363476
4,6-dimethyl-1,7,10,16-tetraoxa-4,13-diazacyclononadecane (PubChem CID 153363476) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4,6-dimethyl-1,7,10,16-tetraoxa-4,13-diazacyclononadecane.
| Compound Name | 4,6-dimethyl-1,7,10,16-tetraoxa-4,13-diazacyclononadecane |
|---|---|
| PubChem CID | 153363476 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 4,6-dimethyl-1,7,10,16-tetraoxa-4,13-diazacyclononadecane |
| SMILES | CC1CN(C)CCOCCCOCCNCCOCCO1 |
| InChI | InChI=1S/C15H32N2O4/c1-15-14-17(2)6-11-19-8-3-7-18-9-4-16-5-10-20-12-13-21-15/h15-16H,3-14H2,1-2H3 |
| InChIKey | HJGAZPMOZWMZOF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |