About (2S)-2,4-dimethylmorpholine;propane
(2S)-2,4-dimethylmorpholine;propane (PubChem CID 178115221) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is (2S)-2,4-dimethylmorpholine;propane.
Molecular Properties
| Compound Name | (2S)-2,4-dimethylmorpholine;propane |
| PubChem CID | 178115221 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | (2S)-2,4-dimethylmorpholine;propane |
| SMILES | CCC.C[C@H]1CN(C)CCO1 |
| InChI | InChI=1S/C6H13NO.C3H8/c1-6-5-7(2)3-4-8-6;1-3-2/h6H,3-5H2,1-2H3;3H2,1-2H3/t6-;/m0./s1 |
| InChIKey | XNKJOCIOJNOKDK-RGMNGODLSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2,4-dimethylmorpholine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethylmorpholine;propane?
The IUPAC name of (2S)-2,4-dimethylmorpholine;propane (CID 178115221) is (2S)-2,4-dimethylmorpholine;propane.
What is the SMILES notation for (2S)-2,4-dimethylmorpholine;propane?
The canonical SMILES for (2S)-2,4-dimethylmorpholine;propane is CCC.C[C@H]1CN(C)CCO1.
What is the InChIKey of (2S)-2,4-dimethylmorpholine;propane?
The InChIKey is XNKJOCIOJNOKDK-RGMNGODLSA-N. The full InChI is InChI=1S/C6H13NO.C3H8/c1-6-5-7(2)3-4-8-6;1-3-2/h6H,3-5H2,1-2H3;3H2,1-2H3/t6-;/m0./s1.
What are the key properties of (2S)-2,4-dimethylmorpholine;propane?
(2S)-2,4-dimethylmorpholine;propane has a molecular weight of 159.27 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethylmorpholine;propane is sourced from PubChem (CID 178115221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).