About azane;4-dodecyl-2-methylmorpholine;hydrobromide
azane;4-dodecyl-2-methylmorpholine;hydrobromide (PubChem CID 174921468) has the molecular formula C17H39BrN2O
and a molecular weight of 367.42 g/mol. Its IUPAC name is azane;4-dodecyl-2-methylmorpholine;hydrobromide.
Molecular Properties
| Compound Name | azane;4-dodecyl-2-methylmorpholine;hydrobromide |
| PubChem CID | 174921468 |
| Molecular Formula | C17H39BrN2O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | azane;4-dodecyl-2-methylmorpholine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCN1CCOC(C)C1.N |
| InChI | InChI=1S/C17H35NO.BrH.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-19-17(2)16-18;;/h17H,3-16H2,1-2H3;1H;1H3 |
| InChIKey | IWVSFSLRLHJHPY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 47.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;4-dodecyl-2-methylmorpholine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-dodecyl-2-methylmorpholine;hydrobromide?
The IUPAC name of azane;4-dodecyl-2-methylmorpholine;hydrobromide (CID 174921468) is azane;4-dodecyl-2-methylmorpholine;hydrobromide.
What is the SMILES notation for azane;4-dodecyl-2-methylmorpholine;hydrobromide?
The canonical SMILES for azane;4-dodecyl-2-methylmorpholine;hydrobromide is Br.CCCCCCCCCCCCN1CCOC(C)C1.N.
What is the InChIKey of azane;4-dodecyl-2-methylmorpholine;hydrobromide?
The InChIKey is IWVSFSLRLHJHPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO.BrH.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-19-17(2)16-18;;/h17H,3-16H2,1-2H3;1H;1H3.
What are the key properties of azane;4-dodecyl-2-methylmorpholine;hydrobromide?
azane;4-dodecyl-2-methylmorpholine;hydrobromide has a molecular weight of 367.42 g/mol, XLogP of 5.37, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-dodecyl-2-methylmorpholine;hydrobromide is sourced from PubChem (CID 174921468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).