About azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid
azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid (PubChem CID 174921461) has the molecular formula C17H40FN2O4P
and a molecular weight of 386.49 g/mol. Its IUPAC name is azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid.
Molecular Properties
| Compound Name | azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid |
| PubChem CID | 174921461 |
| Molecular Formula | C17H40FN2O4P |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid |
| SMILES | CCCCCCCCCCCCN1CCOC(C)C1.N.O=P(O)(O)F |
| InChI | InChI=1S/C17H35NO.FH2O3P.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-19-17(2)16-18;1-5(2,3)4;/h17H,3-16H2,1-2H3;(H2,2,3,4);1H3 |
| InChIKey | UACVUQZEDJINQO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid?
The IUPAC name of azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid (CID 174921461) is azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid.
What is the SMILES notation for azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid?
The canonical SMILES for azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid is CCCCCCCCCCCCN1CCOC(C)C1.N.O=P(O)(O)F.
What is the InChIKey of azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid?
The InChIKey is UACVUQZEDJINQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO.FH2O3P.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-18-14-15-19-17(2)16-18;1-5(2,3)4;/h17H,3-16H2,1-2H3;(H2,2,3,4);1H3.
What are the key properties of azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid?
azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid has a molecular weight of 386.49 g/mol, XLogP of 4.84, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-dodecyl-2-methylmorpholine;fluorophosphonic acid is sourced from PubChem (CID 174921461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).