C7H14N4 — CID 143839553
1-methanimidoyl-3,4-dimethylpiperazin-2-imine (PubChem CID 143839553) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 1-methanimidoyl-3,4-dimethylpiperazin-2-imine.
| Compound Name | 1-methanimidoyl-3,4-dimethylpiperazin-2-imine |
|---|---|
| PubChem CID | 143839553 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 1-methanimidoyl-3,4-dimethylpiperazin-2-imine |
| SMILES | [H]/N=C/N1CCN(C)C(C)/C1=N\[H] |
| InChI | InChI=1S/C7H14N4/c1-6-7(9)11(5-8)4-3-10(6)2/h5-6,8-9H,3-4H2,1-2H3/b8-5+,9-7+ |
| InChIKey | NLSDRQZLSQXDEF-OCIXRKKMSA-N |
| XLogP | 0.21 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|