C6H12N4 — CID 123591161
6-imino-1,5-dimethyl-2,5-dihydropyrazin-3-amine (PubChem CID 123591161) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 6-imino-1,5-dimethyl-2,5-dihydropyrazin-3-amine.
| Compound Name | 6-imino-1,5-dimethyl-2,5-dihydropyrazin-3-amine |
|---|---|
| PubChem CID | 123591161 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 6-imino-1,5-dimethyl-2,5-dihydropyrazin-3-amine |
| SMILES | [H]/N=C1\C(C)N=C(N)CN1C |
| InChI | InChI=1S/C6H12N4/c1-4-6(8)10(2)3-5(7)9-4/h4,8H,3H2,1-2H3,(H2,7,9)/b8-6+ |
| InChIKey | BZTXEHKQMFIDCS-SOFGYWHQSA-N |
| XLogP | -0.35 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|