About 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine
1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine (PubChem CID 141304389) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine.
Molecular Properties
| Compound Name | 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine |
| PubChem CID | 141304389 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine |
| SMILES | CC1CCN(C)C(N)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C7H13N3O2/c1-5-3-4-9(2)7(8)6(5)10(11)12/h5H,3-4,8H2,1-2H3 |
| InChIKey | QDVLMIHVKDNPOO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine?
The IUPAC name of 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine (CID 141304389) is 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine.
What is the SMILES notation for 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine?
The canonical SMILES for 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine is CC1CCN(C)C(N)=C1[N+](=O)[O-].
What is the InChIKey of 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine?
The InChIKey is QDVLMIHVKDNPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-5-3-4-9(2)7(8)6(5)10(11)12/h5H,3-4,8H2,1-2H3.
What are the key properties of 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine?
1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine has a molecular weight of 171.20 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine is sourced from PubChem (CID 141304389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).