C7H13N3O2 — CID 141304389
1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine (PubChem CID 141304389) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine.
| Compound Name | 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 141304389 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1,4-dimethyl-5-nitro-3,4-dihydro-2H-pyridin-6-amine |
| SMILES | CC1CCN(C)C(N)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C7H13N3O2/c1-5-3-4-9(2)7(8)6(5)10(11)12/h5H,3-4,8H2,1-2H3 |
| InChIKey | QDVLMIHVKDNPOO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|