C11H14N2O3 — CID 145284398
3-methyl-1-(4-nitrocyclohexa-1,3-dien-1-yl)pyrrolidin-2-one (PubChem CID 145284398) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-methyl-1-(4-nitrocyclohexa-1,3-dien-1-yl)pyrrolidin-2-one.
| Compound Name | 3-methyl-1-(4-nitrocyclohexa-1,3-dien-1-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 145284398 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-methyl-1-(4-nitrocyclohexa-1,3-dien-1-yl)pyrrolidin-2-one |
| SMILES | CC1CCN(C2=CC=C([N+](=O)[O-])CC2)C1=O |
| InChI | InChI=1S/C11H14N2O3/c1-8-6-7-12(11(8)14)9-2-4-10(5-3-9)13(15)16/h2,4,8H,3,5-7H2,1H3 |
| InChIKey | FKVMLXBYCWTIFQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|