C17H21N3O4 — CID 15170491
1-(2,2-diethyl-6-nitro-1,3-benzoxazin-4-yl)-3-methylpyrrolidin-2-one (PubChem CID 15170491) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(2,2-diethyl-6-nitro-1,3-benzoxazin-4-yl)-3-methylpyrrolidin-2-one.
| Compound Name | 1-(2,2-diethyl-6-nitro-1,3-benzoxazin-4-yl)-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15170491 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(2,2-diethyl-6-nitro-1,3-benzoxazin-4-yl)-3-methylpyrrolidin-2-one |
| SMILES | CCC1(CC)N=C(N2CCC(C)C2=O)c2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C17H21N3O4/c1-4-17(5-2)18-15(19-9-8-11(3)16(19)21)13-10-12(20(22)23)6-7-14(13)24-17/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | JRADQIBNFFFVOL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|