C11H10N4O3 — CID 13035737
6-methyl-9-nitro-2,3-dihydroimidazo[1,2-c]quinazolin-5-one (PubChem CID 13035737) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 6-methyl-9-nitro-2,3-dihydroimidazo[1,2-c]quinazolin-5-one.
| Compound Name | 6-methyl-9-nitro-2,3-dihydroimidazo[1,2-c]quinazolin-5-one |
|---|---|
| PubChem CID | 13035737 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 6-methyl-9-nitro-2,3-dihydroimidazo[1,2-c]quinazolin-5-one |
| SMILES | CN1C(=O)N2CCN=C2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C11H10N4O3/c1-13-9-3-2-7(15(17)18)6-8(9)10-12-4-5-14(10)11(13)16/h2-3,6H,4-5H2,1H3 |
| InChIKey | WRASGCPHSBAUBR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|