C10H9N3O2S — CID 118730103
8-nitro-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole (PubChem CID 118730103) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole.
| Compound Name | 8-nitro-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
|---|---|
| PubChem CID | 118730103 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 8-nitro-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)SN1CCCN=C21 |
| InChI | InChI=1S/C10H9N3O2S/c14-13(15)7-2-3-8-9(6-7)16-12-5-1-4-11-10(8)12/h2-3,6H,1,4-5H2 |
| InChIKey | LCYUAFBCNLDTOX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|