C11H12N2O4 — CID 175096543
6-nitro-2-propyl-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 175096543) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 6-nitro-2-propyl-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | 6-nitro-2-propyl-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 175096543 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 6-nitro-2-propyl-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | CCCC1NC(=O)c2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C11H12N2O4/c1-2-3-10-12-11(14)8-6-7(13(15)16)4-5-9(8)17-10/h4-6,10H,2-3H2,1H3,(H,12,14) |
| InChIKey | MZHCQFGCARRRKR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|