C9H6F2N2O4 — CID 70283133
2-(difluoromethyl)-6-nitro-2,3-dihydro-1,3-benzoxazin-4-one (PubChem CID 70283133) has the molecular formula C9H6F2N2O4 and a molecular weight of 244.15 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-nitro-2,3-dihydro-1,3-benzoxazin-4-one.
| Compound Name | 2-(difluoromethyl)-6-nitro-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 70283133 |
| Molecular Formula | C9H6F2N2O4 |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-(difluoromethyl)-6-nitro-2,3-dihydro-1,3-benzoxazin-4-one |
| SMILES | O=C1NC(C(F)F)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H6F2N2O4/c10-7(11)9-12-8(14)5-3-4(13(15)16)1-2-6(5)17-9/h1-3,7,9H,(H,12,14) |
| InChIKey | PWYLANVUYOAIDY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|