C9H7F2NO3 — CID 174756922
2,3-difluoro-6-nitro-3,4-dihydro-2H-chromene (PubChem CID 174756922) has the molecular formula C9H7F2NO3 and a molecular weight of 215.16 g/mol. Its IUPAC name is 2,3-difluoro-6-nitro-3,4-dihydro-2H-chromene.
| Compound Name | 2,3-difluoro-6-nitro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 174756922 |
| Molecular Formula | C9H7F2NO3 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2,3-difluoro-6-nitro-3,4-dihydro-2H-chromene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CC(F)C(F)O2 |
| InChI | InChI=1S/C9H7F2NO3/c10-7-4-5-3-6(12(13)14)1-2-8(5)15-9(7)11/h1-3,7,9H,4H2 |
| InChIKey | ALMFPIWLEMXTBN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|