C18H28O3 — CID 162415278
(4S,6S,8R,10R)-4,10-bis[(E)-prop-1-enyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecane (PubChem CID 162415278) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4S,6S,8R,10R)-4,10-bis[(E)-prop-1-enyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecane.
| Compound Name | (4S,6S,8R,10R)-4,10-bis[(E)-prop-1-enyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecane |
|---|---|
| PubChem CID | 162415278 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (4S,6S,8R,10R)-4,10-bis[(E)-prop-1-enyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecane |
| SMILES | C/C=C/[C@@H]1CCC[C@]2(CC[C@@]3(CCC[C@H](/C=C/C)O3)O2)O1 |
| InChI | InChI=1S/C18H28O3/c1-3-7-15-9-5-11-17(19-15)13-14-18(21-17)12-6-10-16(20-18)8-4-2/h3-4,7-8,15-16H,5-6,9-14H2,1-2H3/b7-3+,8-4+/t15-,16+,17+,18- |
| InChIKey | HKIMDINXTWGLNM-CKJZBQQLSA-N |
| XLogP | 4.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|