About 2,3,4-trimethyl-2H-pyran
2,3,4-trimethyl-2H-pyran (PubChem CID 19800443) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 2,3,4-trimethyl-2H-pyran.
Molecular Properties
| Compound Name | 2,3,4-trimethyl-2H-pyran |
| PubChem CID | 19800443 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2,3,4-trimethyl-2H-pyran |
| SMILES | CC1C(=C(C=CO1)C)C |
| InChI | InChI=1S/C8H12O/c1-6-4-5-9-8(3)7(6)2/h4-5,8H,1-3H3 |
| InChIKey | XIQCRMKYSDSSNI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 165 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-trimethyl-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethyl-2H-pyran?
The IUPAC name of 2,3,4-trimethyl-2H-pyran (CID 19800443) is 2,3,4-trimethyl-2H-pyran.
What is the SMILES notation for 2,3,4-trimethyl-2H-pyran?
The canonical SMILES for 2,3,4-trimethyl-2H-pyran is CC1C(=C(C=CO1)C)C.
What is the InChIKey of 2,3,4-trimethyl-2H-pyran?
The InChIKey is XIQCRMKYSDSSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-6-4-5-9-8(3)7(6)2/h4-5,8H,1-3H3.
What are the key properties of 2,3,4-trimethyl-2H-pyran?
2,3,4-trimethyl-2H-pyran has a molecular weight of 124.18 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethyl-2H-pyran is sourced from PubChem (CID 19800443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).