C9H12 — CID 163738660
(5R)-5-ethenyl-1,2-dimethylcyclopenta-1,3-diene (PubChem CID 163738660) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is (5R)-5-ethenyl-1,2-dimethylcyclopenta-1,3-diene.
| Compound Name | (5R)-5-ethenyl-1,2-dimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 163738660 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (5R)-5-ethenyl-1,2-dimethylcyclopenta-1,3-diene |
| SMILES | C=C[C@@H]1C=CC(C)=C1C |
| InChI | InChI=1S/C9H12/c1-4-9-6-5-7(2)8(9)3/h4-6,9H,1H2,2-3H3/t9-/m1/s1 |
| InChIKey | LFWBUHFFUZBNHH-SECBINFHSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|