About 5-methylbicyclo[2.1.0]penta-1(5),2-diene
5-methylbicyclo[2.1.0]penta-1(5),2-diene (PubChem CID 86017292) has the molecular formula C6H6
and a molecular weight of 78.11 g/mol. Its IUPAC name is 5-methylbicyclo[2.1.0]penta-1(5),2-diene.
Analyze 5-methylbicyclo[2.1.0]penta-1(5),2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylbicyclo[2.1.0]penta-1(5),2-diene?
The IUPAC name of 5-methylbicyclo[2.1.0]penta-1(5),2-diene (CID 86017292) is 5-methylbicyclo[2.1.0]penta-1(5),2-diene.
What is the SMILES notation for 5-methylbicyclo[2.1.0]penta-1(5),2-diene?
The canonical SMILES for 5-methylbicyclo[2.1.0]penta-1(5),2-diene is CC1=C2C=CC12.
What is the InChIKey of 5-methylbicyclo[2.1.0]penta-1(5),2-diene?
The InChIKey is NQVSYVXTWDLUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6/c1-4-5-2-3-6(4)5/h2-3,5H,1H3.
What are the key properties of 5-methylbicyclo[2.1.0]penta-1(5),2-diene?
5-methylbicyclo[2.1.0]penta-1(5),2-diene has a molecular weight of 78.11 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylbicyclo[2.1.0]penta-1(5),2-diene is sourced from PubChem (CID 86017292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).