C14H16 — CID 98043433
(1aS,3aR)-1,1,3-trimethyl-1a,3a-dihydrocyclopropa[a]naphthalene (PubChem CID 98043433) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1aS,3aR)-1,1,3-trimethyl-1a,3a-dihydrocyclopropa[a]naphthalene.
| Compound Name | (1aS,3aR)-1,1,3-trimethyl-1a,3a-dihydrocyclopropa[a]naphthalene |
|---|---|
| PubChem CID | 98043433 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (1aS,3aR)-1,1,3-trimethyl-1a,3a-dihydrocyclopropa[a]naphthalene |
| SMILES | CC1=C[C@@H]2C(=C3C=CC=C[C@H]13)C2(C)C |
| InChI | InChI=1S/C14H16/c1-9-8-12-13(14(12,2)3)11-7-5-4-6-10(9)11/h4-8,10,12H,1-3H3/t10-,12-/m1/s1 |
| InChIKey | XWHGNPZNXHDISW-ZYHUDNBSSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|