C15H20 — CID 53470693
1,1-dimethyl-2,3,3a,4,5,5a-hexahydrocyclopenta[a]naphthalene (PubChem CID 53470693) has the molecular formula C15H20 and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,1-dimethyl-2,3,3a,4,5,5a-hexahydrocyclopenta[a]naphthalene.
| Compound Name | 1,1-dimethyl-2,3,3a,4,5,5a-hexahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 53470693 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1,1-dimethyl-2,3,3a,4,5,5a-hexahydrocyclopenta[a]naphthalene |
| SMILES | CC1(C)CCC2CCC3C=CC=CC3=C21 |
| InChI | InChI=1S/C15H20/c1-15(2)10-9-12-8-7-11-5-3-4-6-13(11)14(12)15/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | AGLWWRHGJKSHSC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |