C24H28O2 — CID 87699124
methyl 1,2,3,4,4a,5,6,6a,6b,7,8,8a-dodecahydropicene-2-carboxylate (PubChem CID 87699124) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is methyl 1,2,3,4,4a,5,6,6a,6b,7,8,8a-dodecahydropicene-2-carboxylate.
| Compound Name | methyl 1,2,3,4,4a,5,6,6a,6b,7,8,8a-dodecahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 87699124 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | methyl 1,2,3,4,4a,5,6,6a,6b,7,8,8a-dodecahydropicene-2-carboxylate |
| SMILES | COC(=O)C1CCC2CCC3C(=C2C1)C=CC1=C2C=CC=CC2CCC13 |
| InChI | InChI=1S/C24H28O2/c1-26-24(25)17-7-6-16-9-11-21-20-10-8-15-4-2-3-5-18(15)19(20)12-13-22(21)23(16)14-17/h2-5,12-13,15-17,20-21H,6-11,14H2,1H3 |
| InChIKey | ZXJGSTFGXAEIKZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |