C13H17NO — CID 68757422
2,3,4,6,7,7a-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 68757422) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 2,3,4,6,7,7a-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | 2,3,4,6,7,7a-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 68757422 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,3,4,6,7,7a-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | OC1CCN2CCC3C=CC=CC3=C2C1 |
| InChI | InChI=1S/C13H17NO/c15-11-6-8-14-7-5-10-3-1-2-4-12(10)13(14)9-11/h1-4,10-11,15H,5-9H2 |
| InChIKey | LDLMNPLRURDUTK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |