About 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol
1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol (PubChem CID 117249231) has the molecular formula C7H9ClN2O
and a molecular weight of 172.62 g/mol. Its IUPAC name is 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol.
Analyze 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
The IUPAC name of 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol (CID 117249231) is 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol.
What is the SMILES notation for 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
The canonical SMILES for 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol is OC1CCn2cnc(Cl)c2C1.
What is the InChIKey of 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
The InChIKey is QYMUFXCILWVRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O/c8-7-6-3-5(11)1-2-10(6)4-9-7/h4-5,11H,1-3H2.
What are the key properties of 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol has a molecular weight of 172.62 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol is sourced from PubChem (CID 117249231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).