About 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol
3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol (PubChem CID 105429753) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol.
Analyze 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol?
The IUPAC name of 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol (CID 105429753) is 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol.
What is the SMILES notation for 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol?
The canonical SMILES for 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol is Cc1cnc2n1CCC(O)C2.
What is the InChIKey of 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol?
The InChIKey is XVEWHDLEPPHRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-5-9-8-4-7(11)2-3-10(6)8/h5,7,11H,2-4H2,1H3.
What are the key properties of 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol?
3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol has a molecular weight of 152.20 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ol is sourced from PubChem (CID 105429753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).