About 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol
3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol (PubChem CID 84652453) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol.
Analyze 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
The IUPAC name of 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol (CID 84652453) is 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol.
What is the SMILES notation for 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
The canonical SMILES for 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol is CCc1ncc2n1CCC(O)C2.
What is the InChIKey of 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
The InChIKey is OBEFEMQFMUXXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-9-10-6-7-5-8(12)3-4-11(7)9/h6,8,12H,2-5H2,1H3.
What are the key properties of 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol?
3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol has a molecular weight of 166.22 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol is sourced from PubChem (CID 84652453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).