C9H14IN3 — CID 151846225
7-iodo-3,9-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine (PubChem CID 151846225) has the molecular formula C9H14IN3 and a molecular weight of 291.14 g/mol. Its IUPAC name is 7-iodo-3,9-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine.
| Compound Name | 7-iodo-3,9-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine |
|---|---|
| PubChem CID | 151846225 |
| Molecular Formula | C9H14IN3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 7-iodo-3,9-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine |
| SMILES | Cc1cnc2n1CCC(I)CN2C |
| InChI | InChI=1S/C9H14IN3/c1-7-5-11-9-12(2)6-8(10)3-4-13(7)9/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | SHSCZQKKLXOMOM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|