About 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid
2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid (PubChem CID 82408472) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid.
Analyze 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid?
The IUPAC name of 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid (CID 82408472) is 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid.
What is the SMILES notation for 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid?
The canonical SMILES for 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid is CN1CCn2c(CC(=O)O)cnc21.
What is the InChIKey of 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid?
The InChIKey is GGFIGTGMOBCLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-10-2-3-11-6(4-7(12)13)5-9-8(10)11/h5H,2-4H2,1H3,(H,12,13).
What are the key properties of 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid?
2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid has a molecular weight of 181.19 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-2,3-dihydroimidazo[1,2-a]imidazol-5-yl)acetic acid is sourced from PubChem (CID 82408472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).